C19H30N4O2 — CID 125027487
(NZ)-N-[(1S,3R,4S)-3-[4-[(1S,2S,3Z,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]-1,4-diazepan-1-yl]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine (PubChem CID 125027487) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is (NZ)-N-[(1S,3R,4S)-3-[4-[(1S,2S,3Z,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]-1,4-diazepan-1-yl]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(1S,3R,4S)-3-[4-[(1S,2S,3Z,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]-1,4-diazepan-1-yl]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
|---|---|
| PubChem CID | 125027487 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | (NZ)-N-[(1S,3R,4S)-3-[4-[(1S,2S,3Z,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]-1,4-diazepan-1-yl]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
| SMILES | O/N=C1/[C@H]2CC[C@@H](C2)[C@@H]1N1CCCN([C@H]2/C(=N\O)[C@H]3CC[C@H]2C3)CC1 |
| InChI | InChI=1S/C19H30N4O2/c24-20-16-12-2-4-14(10-12)18(16)22-6-1-7-23(9-8-22)19-15-5-3-13(11-15)17(19)21-25/h12-15,18-19,24-25H,1-11H2/b20-16-,21-17-/t12-,13-,14-,15-,18-,19+/m0/s1 |
| InChIKey | HMXVULFBSXELKF-JJLLEGIVSA-N |
| XLogP | 2.25 |
| TPSA | 71.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|