C14H19N3O — CID 125027489
(NE)-N-[(1S,3R,4S)-3-(2-methyl-2-phenylhydrazinyl)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine (PubChem CID 125027489) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is (NE)-N-[(1S,3R,4S)-3-(2-methyl-2-phenylhydrazinyl)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine.
| Compound Name | (NE)-N-[(1S,3R,4S)-3-(2-methyl-2-phenylhydrazinyl)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
|---|---|
| PubChem CID | 125027489 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | (NE)-N-[(1S,3R,4S)-3-(2-methyl-2-phenylhydrazinyl)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
| SMILES | CN(N[C@H]1/C(=N/O)[C@H]2CC[C@H]1C2)c1ccccc1 |
| InChI | InChI=1S/C14H19N3O/c1-17(12-5-3-2-4-6-12)15-13-10-7-8-11(9-10)14(13)16-18/h2-6,10-11,13,15,18H,7-9H2,1H3/b16-14+/t10-,11-,13+/m0/s1 |
| InChIKey | IVOVNBLLTFKAJN-ARXWXMHWSA-N |
| XLogP | 2.26 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|