C15H20N2O — CID 125027526
(NZ)-N-[(1S,3S,4S)-3-[benzyl(methyl)amino]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine (PubChem CID 125027526) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is (NZ)-N-[(1S,3S,4S)-3-[benzyl(methyl)amino]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(1S,3S,4S)-3-[benzyl(methyl)amino]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
|---|---|
| PubChem CID | 125027526 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (NZ)-N-[(1S,3S,4S)-3-[benzyl(methyl)amino]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
| SMILES | CN(Cc1ccccc1)[C@@H]1/C(=N\O)[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C15H20N2O/c1-17(10-11-5-3-2-4-6-11)15-13-8-7-12(9-13)14(15)16-18/h2-6,12-13,15,18H,7-10H2,1H3/b16-14-/t12-,13-,15-/m0/s1 |
| InChIKey | YNZIHLDKDXMMJM-LHTXOPKDSA-N |
| XLogP | 2.75 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|