C27H44N4O2 — CID 125027561
(NZ)-N-[(1S,3R,4S)-3-[4-[3-[1-[(1S,2S,3E,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]piperidin-4-yl]propyl]piperidin-1-yl]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine (PubChem CID 125027561) has the molecular formula C27H44N4O2 and a molecular weight of 456.68 g/mol. Its IUPAC name is (NZ)-N-[(1S,3R,4S)-3-[4-[3-[1-[(1S,2S,3E,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]piperidin-4-yl]propyl]piperidin-1-yl]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(1S,3R,4S)-3-[4-[3-[1-[(1S,2S,3E,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]piperidin-4-yl]propyl]piperidin-1-yl]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
|---|---|
| PubChem CID | 125027561 |
| Molecular Formula | C27H44N4O2 |
| Molecular Weight | 456.68 g/mol |
| Exact Mass | 456.35 |
| IUPAC Name | (NZ)-N-[(1S,3R,4S)-3-[4-[3-[1-[(1S,2S,3E,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]piperidin-4-yl]propyl]piperidin-1-yl]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
| SMILES | O/N=C1/[C@H]2CC[C@@H](C2)[C@H]1N1CCC(CCCC2CCN([C@@H]3/C(=N/O)[C@H]4CC[C@H]3C4)CC2)CC1 |
| InChI | InChI=1S/C27H44N4O2/c32-28-24-20-4-6-22(16-20)26(24)30-12-8-18(9-13-30)2-1-3-19-10-14-31(15-11-19)27-23-7-5-21(17-23)25(27)29-33/h18-23,26-27,32-33H,1-17H2/b28-24-,29-25+/t20-,21-,22-,23-,26+,27-/m0/s1 |
| InChIKey | PWOVOQUQSFSBBG-GPQJEMKBSA-N |
| XLogP | 4.84 |
| TPSA | 71.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.68 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|