C19H28O4 — CID 125028084
(5S,8R,9R,10S,13S,14R,16S)-9,16-dihydroxy-10,13-dimethyl-1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,11-dione (PubChem CID 125028084) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is (5S,8R,9R,10S,13S,14R,16S)-9,16-dihydroxy-10,13-dimethyl-1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,11-dione.
| Compound Name | (5S,8R,9R,10S,13S,14R,16S)-9,16-dihydroxy-10,13-dimethyl-1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,11-dione |
|---|---|
| PubChem CID | 125028084 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (5S,8R,9R,10S,13S,14R,16S)-9,16-dihydroxy-10,13-dimethyl-1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,11-dione |
| SMILES | C[C@]12CC(=O)[C@@]3(O)[C@H](CC[C@H]4CC(=O)CC[C@@]43C)[C@H]1C[C@H](O)C2 |
| InChI | InChI=1S/C19H28O4/c1-17-9-13(21)8-15(17)14-4-3-11-7-12(20)5-6-18(11,2)19(14,23)16(22)10-17/h11,13-15,21,23H,3-10H2,1-2H3/t11-,13-,14+,15+,17-,18-,19-/m0/s1 |
| InChIKey | NDNYWDRLRPSNOT-JENYNMIDSA-N |
| XLogP | 2.25 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |