C8H12Br2O — CID 125028565
(1S,4R,5S,8S)-4,5-dibromo-9-oxabicyclo[6.1.0]nonane (PubChem CID 125028565) has the molecular formula C8H12Br2O and a molecular weight of 283.99 g/mol. Its IUPAC name is (1S,4R,5S,8S)-4,5-dibromo-9-oxabicyclo[6.1.0]nonane.
| Compound Name | (1S,4R,5S,8S)-4,5-dibromo-9-oxabicyclo[6.1.0]nonane |
|---|---|
| PubChem CID | 125028565 |
| Molecular Formula | C8H12Br2O |
| Molecular Weight | 283.99 g/mol |
| Exact Mass | 281.93 |
| IUPAC Name | (1S,4R,5S,8S)-4,5-dibromo-9-oxabicyclo[6.1.0]nonane |
| SMILES | Br[C@@H]1CC[C@@H]2O[C@H]2CC[C@@H]1Br |
| InChI | InChI=1S/C8H12Br2O/c9-5-1-3-7-8(11-7)4-2-6(5)10/h5-8H,1-4H2/t5-,6+,7-,8-/m0/s1 |
| InChIKey | FDVJISGFGLBDFP-YWIQKCBGSA-N |
| XLogP | 2.85 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.99 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|