C21H32O4 — CID 125028624
(1R,4aS,4bS,6aS,8S,10aS,10bS,12aR)-1,8-dihydroxy-1,10a,12a-trimethyl-4,4a,4b,5,6,6a,7,8,9,10,10b,12-dodecahydro-3H-chrysene-2,11-dione (PubChem CID 125028624) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is (1R,4aS,4bS,6aS,8S,10aS,10bS,12aR)-1,8-dihydroxy-1,10a,12a-trimethyl-4,4a,4b,5,6,6a,7,8,9,10,10b,12-dodecahydro-3H-chrysene-2,11-dione.
| Compound Name | (1R,4aS,4bS,6aS,8S,10aS,10bS,12aR)-1,8-dihydroxy-1,10a,12a-trimethyl-4,4a,4b,5,6,6a,7,8,9,10,10b,12-dodecahydro-3H-chrysene-2,11-dione |
|---|---|
| PubChem CID | 125028624 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (1R,4aS,4bS,6aS,8S,10aS,10bS,12aR)-1,8-dihydroxy-1,10a,12a-trimethyl-4,4a,4b,5,6,6a,7,8,9,10,10b,12-dodecahydro-3H-chrysene-2,11-dione |
| SMILES | C[C@]12CC[C@H](O)C[C@@H]1CC[C@@H]1[C@@H]2C(=O)C[C@]2(C)[C@H]1CCC(=O)[C@]2(C)O |
| InChI | InChI=1S/C21H32O4/c1-19-9-8-13(22)10-12(19)4-5-14-15-6-7-17(24)21(3,25)20(15,2)11-16(23)18(14)19/h12-15,18,22,25H,4-11H2,1-3H3/t12-,13-,14-,15-,18+,19-,20+,21-/m0/s1 |
| InChIKey | KKPWLTSTAUZZSR-YAUMQBEUSA-N |
| XLogP | 2.89 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |