About (1R,8R)-bicyclo[6.1.0]nonane
(1R,8R)-bicyclo[6.1.0]nonane (PubChem CID 12502931) has the molecular formula C9H16
and a molecular weight of 124.23 g/mol. Its IUPAC name is (1R,8R)-bicyclo[6.1.0]nonane.
Molecular Properties
| Compound Name | (1R,8R)-bicyclo[6.1.0]nonane |
| PubChem CID | 12502931 |
| Molecular Formula | C9H16 |
| Molecular Weight | 124.23 g/mol |
| Exact Mass | 124.13 |
| IUPAC Name | (1R,8R)-bicyclo[6.1.0]nonane |
| SMILES | C1CCC[C@@H]2C[C@H]2CC1 |
| InChI | InChI=1S/C9H16/c1-2-4-6-9-7-8(9)5-3-1/h8-9H,1-7H2/t8-,9-/m1/s1 |
| InChIKey | FYECUAIUGWFPJF-RKDXNWHRSA-N |
| XLogP | 2.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.23 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (1R,8R)-bicyclo[6.1.0]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,8R)-bicyclo[6.1.0]nonane?
The IUPAC name of (1R,8R)-bicyclo[6.1.0]nonane (CID 12502931) is (1R,8R)-bicyclo[6.1.0]nonane.
What is the SMILES notation for (1R,8R)-bicyclo[6.1.0]nonane?
The canonical SMILES for (1R,8R)-bicyclo[6.1.0]nonane is C1CCC[C@@H]2C[C@H]2CC1.
What is the InChIKey of (1R,8R)-bicyclo[6.1.0]nonane?
The InChIKey is FYECUAIUGWFPJF-RKDXNWHRSA-N. The full InChI is InChI=1S/C9H16/c1-2-4-6-9-7-8(9)5-3-1/h8-9H,1-7H2/t8-,9-/m1/s1.
What are the key properties of (1R,8R)-bicyclo[6.1.0]nonane?
(1R,8R)-bicyclo[6.1.0]nonane has a molecular weight of 124.23 g/mol, XLogP of 2.98, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,8R)-bicyclo[6.1.0]nonane is sourced from PubChem (CID 12502931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).