C30H44O4 — CID 125029482
[(1S,2R,5S,6R,10R,13R,15S)-5-[(E,2R,5S)-5,6-dimethylhept-3-en-2-yl]-6,10-dimethyl-16,17-dioxapentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-8,18-dien-13-yl] acetate (PubChem CID 125029482) has the molecular formula C30H44O4 and a molecular weight of 468.68 g/mol. Its IUPAC name is [(1S,2R,5S,6R,10R,13R,15S)-5-[(E,2R,5S)-5,6-dimethylhept-3-en-2-yl]-6,10-dimethyl-16,17-dioxapentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-8,18-dien-13-yl] acetate.
| Compound Name | [(1S,2R,5S,6R,10R,13R,15S)-5-[(E,2R,5S)-5,6-dimethylhept-3-en-2-yl]-6,10-dimethyl-16,17-dioxapentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-8,18-dien-13-yl] acetate |
|---|---|
| PubChem CID | 125029482 |
| Molecular Formula | C30H44O4 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | [(1S,2R,5S,6R,10R,13R,15S)-5-[(E,2R,5S)-5,6-dimethylhept-3-en-2-yl]-6,10-dimethyl-16,17-dioxapentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-8,18-dien-13-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@]2(C)C3=CC[C@@]4(C)[C@@H](CC[C@H]4[C@H](C)/C=C/[C@@H](C)C(C)C)[C@@]34C=C[C@]2(C1)OO4 |
| InChI | InChI=1S/C30H44O4/c1-19(2)20(3)8-9-21(4)24-10-11-25-27(24,6)14-13-26-28(7)15-12-23(32-22(5)31)18-29(28)16-17-30(25,26)34-33-29/h8-9,13,16-17,19-21,23-25H,10-12,14-15,18H2,1-7H3/b9-8+/t20-,21-,23-,24+,25-,27-,28-,29-,30+/m1/s1 |
| InChIKey | IDGDXRNODLQSAB-NOBMVRDKSA-N |
| XLogP | 6.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|