C25H37BrO5 — CID 125029932
[(3R,5S,8R,9R,10S,12R,13S,14R,17R)-17-[(1S)-1-acetyloxyethyl]-12-bromo-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 125029932) has the molecular formula C25H37BrO5 and a molecular weight of 497.47 g/mol. Its IUPAC name is [(3R,5S,8R,9R,10S,12R,13S,14R,17R)-17-[(1S)-1-acetyloxyethyl]-12-bromo-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3R,5S,8R,9R,10S,12R,13S,14R,17R)-17-[(1S)-1-acetyloxyethyl]-12-bromo-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 125029932 |
| Molecular Formula | C25H37BrO5 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | [(3R,5S,8R,9R,10S,12R,13S,14R,17R)-17-[(1S)-1-acetyloxyethyl]-12-bromo-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@@]2(C)[C@@H](CC[C@H]3[C@H]2C(=O)[C@H](Br)[C@@]2(C)[C@@H]3CC[C@H]2[C@H](C)OC(C)=O)C1 |
| InChI | InChI=1S/C25H37BrO5/c1-13(30-14(2)27)19-8-9-20-18-7-6-16-12-17(31-15(3)28)10-11-24(16,4)21(18)22(29)23(26)25(19,20)5/h13,16-21,23H,6-12H2,1-5H3/t13-,16-,17+,18+,19-,20+,21-,23-,24-,25+/m0/s1 |
| InChIKey | AADCNQYPXUSRGN-BITSKVPHSA-N |
| XLogP | 5.08 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|