C26H35NO4 — CID 125030198
[(2E)-2-[(3R,8S,9R,10R,13S,14R)-3-acetyloxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]-2-cyanoethyl] acetate (PubChem CID 125030198) has the molecular formula C26H35NO4 and a molecular weight of 425.57 g/mol. Its IUPAC name is [(2E)-2-[(3R,8S,9R,10R,13S,14R)-3-acetyloxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]-2-cyanoethyl] acetate.
| Compound Name | [(2E)-2-[(3R,8S,9R,10R,13S,14R)-3-acetyloxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]-2-cyanoethyl] acetate |
|---|---|
| PubChem CID | 125030198 |
| Molecular Formula | C26H35NO4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | [(2E)-2-[(3R,8S,9R,10R,13S,14R)-3-acetyloxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]-2-cyanoethyl] acetate |
| SMILES | CC(=O)OC/C(C#N)=C1\CC[C@@H]2[C@H]3CC=C4C[C@H](OC(C)=O)CC[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C26H35NO4/c1-16(28)30-15-18(14-27)22-7-8-23-21-6-5-19-13-20(31-17(2)29)9-11-25(19,3)24(21)10-12-26(22,23)4/h5,20-21,23-24H,6-13,15H2,1-4H3/b22-18+/t20-,21-,23-,24-,25+,26-/m1/s1 |
| InChIKey | CKWFORLOHLVCPJ-BZDDJVNSSA-N |
| XLogP | 5.26 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|