C27H42O7 — CID 125030355
[(3R,5S,8S,9S,10R,11R,13S,14R,17R)-11-acetyloxy-17-[(1R)-1-acetyloxyethyl]-5-hydroxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 125030355) has the molecular formula C27H42O7 and a molecular weight of 478.63 g/mol. Its IUPAC name is [(3R,5S,8S,9S,10R,11R,13S,14R,17R)-11-acetyloxy-17-[(1R)-1-acetyloxyethyl]-5-hydroxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3R,5S,8S,9S,10R,11R,13S,14R,17R)-11-acetyloxy-17-[(1R)-1-acetyloxyethyl]-5-hydroxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 125030355 |
| Molecular Formula | C27H42O7 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | [(3R,5S,8S,9S,10R,11R,13S,14R,17R)-11-acetyloxy-17-[(1R)-1-acetyloxyethyl]-5-hydroxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@]2(C)[C@@H]3[C@@H](CC[C@]2(O)C1)[C@H]1CC[C@@H]([C@@H](C)OC(C)=O)[C@@]1(C)C[C@H]3OC(C)=O |
| InChI | InChI=1S/C27H42O7/c1-15(32-16(2)28)21-7-8-22-20-10-12-27(31)13-19(33-17(3)29)9-11-26(27,6)24(20)23(34-18(4)30)14-25(21,22)5/h15,19-24,31H,7-14H2,1-6H3/t15-,19-,20+,21+,22-,23-,24-,25-,26-,27+/m1/s1 |
| InChIKey | FDUDUOISJCKURU-CZNPZYBMSA-N |
| XLogP | 4.19 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|