C30H49BrO3 — CID 125030526
[(2R,5S,8S,9S,10S,11R,13S,14R,17R)-2-bromo-17-[(2R,5S)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-yl] acetate (PubChem CID 125030526) has the molecular formula C30H49BrO3 and a molecular weight of 537.62 g/mol. Its IUPAC name is [(2R,5S,8S,9S,10S,11R,13S,14R,17R)-2-bromo-17-[(2R,5S)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-yl] acetate.
| Compound Name | [(2R,5S,8S,9S,10S,11R,13S,14R,17R)-2-bromo-17-[(2R,5S)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-yl] acetate |
|---|---|
| PubChem CID | 125030526 |
| Molecular Formula | C30H49BrO3 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | [(2R,5S,8S,9S,10S,11R,13S,14R,17R)-2-bromo-17-[(2R,5S)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@]2(C)[C@H](CC[C@@H]2[C@H](C)CC[C@H](C)C(C)C)[C@@H]2CC[C@H]3CC(=O)[C@H](Br)C[C@]3(C)[C@H]21 |
| InChI | InChI=1S/C30H49BrO3/c1-17(2)18(3)8-9-19(4)23-12-13-24-22-11-10-21-14-26(33)25(31)15-29(21,6)28(22)27(34-20(5)32)16-30(23,24)7/h17-19,21-25,27-28H,8-16H2,1-7H3/t18-,19+,21-,22-,23+,24+,25+,27+,28+,29-,30-/m0/s1 |
| InChIKey | GXFFJSAUBRBFMJ-NAWDTXNDSA-N |
| XLogP | 7.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|