C27H47NO3 — CID 125030874
(3S,5R,6E,8R,9R,10R,13R,14R,17R)-6-hydroxyimino-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,5-diol (PubChem CID 125030874) has the molecular formula C27H47NO3 and a molecular weight of 433.68 g/mol. Its IUPAC name is (3S,5R,6E,8R,9R,10R,13R,14R,17R)-6-hydroxyimino-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,5-diol.
| Compound Name | (3S,5R,6E,8R,9R,10R,13R,14R,17R)-6-hydroxyimino-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,5-diol |
|---|---|
| PubChem CID | 125030874 |
| Molecular Formula | C27H47NO3 |
| Molecular Weight | 433.68 g/mol |
| Exact Mass | 433.36 |
| IUPAC Name | (3S,5R,6E,8R,9R,10R,13R,14R,17R)-6-hydroxyimino-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,5-diol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@@H]2[C@H]3C/C(=N\O)[C@@]4(O)C[C@@H](O)CC[C@]4(C)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C27H47NO3/c1-17(2)7-6-8-18(3)21-9-10-22-20-15-24(28-31)27(30)16-19(29)11-14-26(27,5)23(20)12-13-25(21,22)4/h17-23,29-31H,6-16H2,1-5H3/b28-24+/t18-,19+,20-,21-,22-,23-,25-,26-,27+/m1/s1 |
| InChIKey | JVBJMRIVVNLPKI-GELIWDPISA-N |
| XLogP | 6.02 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.68 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|