C27H46ClNO — CID 125031419
(4R,5R,8S,9S,10R,13R,14R,17S)-4-chloro-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-4-nitroso-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene (PubChem CID 125031419) has the molecular formula C27H46ClNO and a molecular weight of 436.12 g/mol. Its IUPAC name is (4R,5R,8S,9S,10R,13R,14R,17S)-4-chloro-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-4-nitroso-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene.
| Compound Name | (4R,5R,8S,9S,10R,13R,14R,17S)-4-chloro-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-4-nitroso-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 125031419 |
| Molecular Formula | C27H46ClNO |
| Molecular Weight | 436.12 g/mol |
| Exact Mass | 435.33 |
| IUPAC Name | (4R,5R,8S,9S,10R,13R,14R,17S)-4-chloro-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-4-nitroso-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene |
| SMILES | CC(C)CCC[C@@H](C)[C@@H]1CC[C@@H]2[C@@H]3CC[C@@H]4[C@](C)(CCC[C@]4(Cl)N=O)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C27H46ClNO/c1-18(2)8-6-9-19(3)21-11-12-22-20-10-13-24-26(5,15-7-16-27(24,28)29-30)23(20)14-17-25(21,22)4/h18-24H,6-17H2,1-5H3/t19-,20+,21+,22-,23+,24-,25-,26-,27+/m1/s1 |
| InChIKey | OFMIYRIIUFCNER-OBVGOMDRSA-N |
| XLogP | 8.81 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.12 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|