C25H34O6 — CID 125031679
[(6R,8S,9S,10S,11R,13S,14R,17R)-17-acetyl-11-acetyloxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-6-yl] acetate (PubChem CID 125031679) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is [(6R,8S,9S,10S,11R,13S,14R,17R)-17-acetyl-11-acetyloxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-6-yl] acetate.
| Compound Name | [(6R,8S,9S,10S,11R,13S,14R,17R)-17-acetyl-11-acetyloxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-6-yl] acetate |
|---|---|
| PubChem CID | 125031679 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | [(6R,8S,9S,10S,11R,13S,14R,17R)-17-acetyl-11-acetyloxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-6-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H]2[C@H]([C@H](OC(C)=O)C[C@@]3(C)[C@@H]2CC[C@H]3C(C)=O)[C@]2(C)CCC(=O)C=C12 |
| InChI | InChI=1S/C25H34O6/c1-13(26)18-6-7-19-17-11-21(30-14(2)27)20-10-16(29)8-9-24(20,4)23(17)22(31-15(3)28)12-25(18,19)5/h10,17-19,21-23H,6-9,11-12H2,1-5H3/t17-,18-,19+,21+,22+,23+,24+,25+/m0/s1 |
| InChIKey | QMVKBOXOOMXFOM-ZPOBSZBPSA-N |
| XLogP | 3.81 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |