C19H27BrO2 — CID 125031719
(5S,8S,9S,10S,12R,13R,14R)-12-bromo-10,13-dimethyl-2,4,5,6,7,8,9,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,11-dione (PubChem CID 125031719) has the molecular formula C19H27BrO2 and a molecular weight of 367.33 g/mol. Its IUPAC name is (5S,8S,9S,10S,12R,13R,14R)-12-bromo-10,13-dimethyl-2,4,5,6,7,8,9,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,11-dione.
| Compound Name | (5S,8S,9S,10S,12R,13R,14R)-12-bromo-10,13-dimethyl-2,4,5,6,7,8,9,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,11-dione |
|---|---|
| PubChem CID | 125031719 |
| Molecular Formula | C19H27BrO2 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (5S,8S,9S,10S,12R,13R,14R)-12-bromo-10,13-dimethyl-2,4,5,6,7,8,9,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,11-dione |
| SMILES | C[C@]12CCC(=O)C[C@@H]1CC[C@H]1[C@H]3CCC[C@@]3(C)[C@@H](Br)C(=O)[C@@H]12 |
| InChI | InChI=1S/C19H27BrO2/c1-18-9-7-12(21)10-11(18)5-6-13-14-4-3-8-19(14,2)17(20)16(22)15(13)18/h11,13-15,17H,3-10H2,1-2H3/t11-,13-,14+,15+,17-,18-,19+/m0/s1 |
| InChIKey | QWGULHWDLZYDCS-MWZXCWOKSA-N |
| XLogP | 4.54 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|