C23H35BrO3 — CID 125032256
[(5R,8R,9S,10S,13R,14R,16R,17S)-17-acetyl-17-bromo-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-16-yl] acetate (PubChem CID 125032256) has the molecular formula C23H35BrO3 and a molecular weight of 439.43 g/mol. Its IUPAC name is [(5R,8R,9S,10S,13R,14R,16R,17S)-17-acetyl-17-bromo-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-16-yl] acetate.
| Compound Name | [(5R,8R,9S,10S,13R,14R,16R,17S)-17-acetyl-17-bromo-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-16-yl] acetate |
|---|---|
| PubChem CID | 125032256 |
| Molecular Formula | C23H35BrO3 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | [(5R,8R,9S,10S,13R,14R,16R,17S)-17-acetyl-17-bromo-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-16-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H]2[C@@H]3CC[C@H]4CCCC[C@]4(C)[C@H]3CC[C@@]2(C)[C@@]1(Br)C(C)=O |
| InChI | InChI=1S/C23H35BrO3/c1-14(25)23(24)20(27-15(2)26)13-19-17-9-8-16-7-5-6-11-21(16,3)18(17)10-12-22(19,23)4/h16-20H,5-13H2,1-4H3/t16-,17-,18+,19-,20-,21+,22-,23-/m1/s1 |
| InChIKey | WDDPCUNSIABLCD-BEEPAOLHSA-N |
| XLogP | 5.68 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|