C29H51N — CID 125032284
(3R,8S,9S,10R,13S,14R,17S)-N,N,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine (PubChem CID 125032284) has the molecular formula C29H51N and a molecular weight of 413.73 g/mol. Its IUPAC name is (3R,8S,9S,10R,13S,14R,17S)-N,N,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine.
| Compound Name | (3R,8S,9S,10R,13S,14R,17S)-N,N,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine |
|---|---|
| PubChem CID | 125032284 |
| Molecular Formula | C29H51N |
| Molecular Weight | 413.73 g/mol |
| Exact Mass | 413.40 |
| IUPAC Name | (3R,8S,9S,10R,13S,14R,17S)-N,N,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine |
| SMILES | CC(C)CCC[C@@H](C)[C@@H]1CC[C@@H]2[C@@H]3CC=C4C[C@H](N(C)C)CC[C@]4(C)[C@H]3CC[C@]21C |
| InChI | InChI=1S/C29H51N/c1-20(2)9-8-10-21(3)25-13-14-26-24-12-11-22-19-23(30(6)7)15-17-28(22,4)27(24)16-18-29(25,26)5/h11,20-21,23-27H,8-10,12-19H2,1-7H3/t21-,23-,24+,25+,26-,27+,28+,29+/m1/s1 |
| InChIKey | WHZUCKVXGABTPN-UOCHIZNBSA-N |
| XLogP | 7.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.73 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|