C27H46N2O2 — CID 125032667
(NE)-N-[(5R,8S,9S,10R,13R,14R,17S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-4-ylidene]nitramide (PubChem CID 125032667) has the molecular formula C27H46N2O2 and a molecular weight of 430.68 g/mol. Its IUPAC name is (NE)-N-[(5R,8S,9S,10R,13R,14R,17S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-4-ylidene]nitramide.
| Compound Name | (NE)-N-[(5R,8S,9S,10R,13R,14R,17S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-4-ylidene]nitramide |
|---|---|
| PubChem CID | 125032667 |
| Molecular Formula | C27H46N2O2 |
| Molecular Weight | 430.68 g/mol |
| Exact Mass | 430.36 |
| IUPAC Name | (NE)-N-[(5R,8S,9S,10R,13R,14R,17S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-4-ylidene]nitramide |
| SMILES | CC(C)CCC[C@@H](C)[C@@H]1CC[C@@H]2[C@@H]3CC[C@H]4/C(=N/[N+](=O)[O-])CCC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C27H46N2O2/c1-18(2)8-6-9-19(3)21-13-14-22-20-11-12-24-25(28-29(30)31)10-7-16-26(24,4)23(20)15-17-27(21,22)5/h18-24H,6-17H2,1-5H3/b28-25+/t19-,20+,21+,22-,23+,24+,26-,27-/m1/s1 |
| InChIKey | ZJFYDPFCQFKJHC-XWQMFHBVSA-N |
| XLogP | 7.74 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.68 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|