C17H29NO9 — CID 125033053
N-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]oxan-3-yl]acetamide (PubChem CID 125033053) has the molecular formula C17H29NO9 and a molecular weight of 391.42 g/mol. Its IUPAC name is N-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]oxan-3-yl]acetamide.
| Compound Name | N-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 125033053 |
| Molecular Formula | C17H29NO9 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | N-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]oxan-3-yl]acetamide |
| SMILES | C#CCOCCOCCOCCO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C17H29NO9/c1-3-4-23-5-6-24-7-8-25-9-10-26-17-14(18-12(2)20)16(22)15(21)13(11-19)27-17/h1,13-17,19,21-22H,4-11H2,2H3,(H,18,20)/t13-,14-,15-,16-,17-/m1/s1 |
| InChIKey | NKSPHILIVROOQP-WRQOLXDDSA-N |
| XLogP | -2.37 |
| TPSA | 135.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|