C17H24O — CID 125033263
(1R,2S,5S,6S,8R,9S,14S)-pentacyclo[6.6.1.12,5.19,14.01,6]heptadecan-16-one (PubChem CID 125033263) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is (1R,2S,5S,6S,8R,9S,14S)-pentacyclo[6.6.1.12,5.19,14.01,6]heptadecan-16-one.
| Compound Name | (1R,2S,5S,6S,8R,9S,14S)-pentacyclo[6.6.1.12,5.19,14.01,6]heptadecan-16-one |
|---|---|
| PubChem CID | 125033263 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | (1R,2S,5S,6S,8R,9S,14S)-pentacyclo[6.6.1.12,5.19,14.01,6]heptadecan-16-one |
| SMILES | O=C1[C@H]2CCCC[C@H]1[C@@]13C[C@H]2C[C@H]1[C@H]1CC[C@H]3C1 |
| InChI | InChI=1S/C17H24O/c18-16-13-3-1-2-4-14(16)17-9-11(13)8-15(17)10-5-6-12(17)7-10/h10-15H,1-9H2/t10-,11+,12-,13-,14+,15-,17-/m0/s1 |
| InChIKey | AOEUPYAFASLOBB-JBMZLJQVSA-N |
| XLogP | 3.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |