C12H13N3O5 — CID 125033775
N-[(1S,3R,5R,7R,8R,9R,10S,11S)-6,6-dinitro-2-pentacyclo[5.4.1.03,10.05,9.08,11]dodecanylidene]hydroxylamine (PubChem CID 125033775) has the molecular formula C12H13N3O5 and a molecular weight of 279.25 g/mol. Its IUPAC name is N-[(1S,3R,5R,7R,8R,9R,10S,11S)-6,6-dinitro-2-pentacyclo[5.4.1.03,10.05,9.08,11]dodecanylidene]hydroxylamine.
| Compound Name | N-[(1S,3R,5R,7R,8R,9R,10S,11S)-6,6-dinitro-2-pentacyclo[5.4.1.03,10.05,9.08,11]dodecanylidene]hydroxylamine |
|---|---|
| PubChem CID | 125033775 |
| Molecular Formula | C12H13N3O5 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | N-[(1S,3R,5R,7R,8R,9R,10S,11S)-6,6-dinitro-2-pentacyclo[5.4.1.03,10.05,9.08,11]dodecanylidene]hydroxylamine |
| SMILES | O=[N+]([O-])C1([N+](=O)[O-])[C@@H]2C[C@@H]3/C(=N/O)[C@@H]4C[C@@H]1[C@H]1[C@H]2[C@@H]3[C@@H]14 |
| InChI | InChI=1S/C12H13N3O5/c16-13-11-3-1-5-9-7(3)8-4(11)2-6(10(8)9)12(5,14(17)18)15(19)20/h3-10,16H,1-2H2/b13-11-/t3-,4+,5+,6+,7-,8-,9+,10+/m0/s1 |
| InChIKey | DVIHSUYDZGBEPA-PGSWXRJHSA-N |
| XLogP | 0.84 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|