C16H16O3 — CID 125034505
(1R,3R,8S,10R,11S,15R)-13-oxahexacyclo[8.5.1.13,6.02,9.04,8.011,15]heptadec-2(9)-ene-12,14-dione (PubChem CID 125034505) has the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. Its IUPAC name is (1R,3R,8S,10R,11S,15R)-13-oxahexacyclo[8.5.1.13,6.02,9.04,8.011,15]heptadec-2(9)-ene-12,14-dione.
| Compound Name | (1R,3R,8S,10R,11S,15R)-13-oxahexacyclo[8.5.1.13,6.02,9.04,8.011,15]heptadec-2(9)-ene-12,14-dione |
|---|---|
| PubChem CID | 125034505 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (1R,3R,8S,10R,11S,15R)-13-oxahexacyclo[8.5.1.13,6.02,9.04,8.011,15]heptadec-2(9)-ene-12,14-dione |
| SMILES | O=C1OC(=O)[C@H]2[C@@H]1[C@H]1C[C@H]2C2=C1[C@H]1CC3CC1[C@H]2C3 |
| InChI | InChI=1S/C16H16O3/c17-15-13-9-4-10(14(13)16(18)19-15)12-8-3-5-1-6(8)7(2-5)11(9)12/h5-10,13-14H,1-4H2/t5?,6?,7-,8+,9-,10-,13-,14+/m0/s1 |
| InChIKey | JWKGKWVATJJPBG-HCCDYVBPSA-N |
| XLogP | 1.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|