C12H13NO2 — CID 125034811
2-[(1S,2R,4S,5S,6R,7R,8R,10R,12S)-3,11-dioxapentacyclo[6.4.0.02,4.05,12.06,10]dodecan-7-yl]acetonitrile (PubChem CID 125034811) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 2-[(1S,2R,4S,5S,6R,7R,8R,10R,12S)-3,11-dioxapentacyclo[6.4.0.02,4.05,12.06,10]dodecan-7-yl]acetonitrile.
| Compound Name | 2-[(1S,2R,4S,5S,6R,7R,8R,10R,12S)-3,11-dioxapentacyclo[6.4.0.02,4.05,12.06,10]dodecan-7-yl]acetonitrile |
|---|---|
| PubChem CID | 125034811 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 2-[(1S,2R,4S,5S,6R,7R,8R,10R,12S)-3,11-dioxapentacyclo[6.4.0.02,4.05,12.06,10]dodecan-7-yl]acetonitrile |
| SMILES | N#CC[C@@H]1[C@H]2C[C@H]3O[C@H]4[C@H]2[C@H]2O[C@H]2[C@H]4[C@@H]13 |
| InChI | InChI=1S/C12H13NO2/c13-2-1-4-5-3-6-7(4)9-10(14-6)8(5)11-12(9)15-11/h4-12H,1,3H2/t4-,5-,6-,7+,8+,9+,10+,11-,12+/m1/s1 |
| InChIKey | LSMCEKVFBLMZBG-PFTXCFOBSA-N |
| XLogP | 0.95 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|