C18H22O2 — CID 125034852
(1S,3S,6R,8S,9S,13R)-3,15,15-trimethylpentacyclo[6.5.1.13,6.02,7.09,13]pentadec-2(7)-ene-10,12-dione (PubChem CID 125034852) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is (1S,3S,6R,8S,9S,13R)-3,15,15-trimethylpentacyclo[6.5.1.13,6.02,7.09,13]pentadec-2(7)-ene-10,12-dione.
| Compound Name | (1S,3S,6R,8S,9S,13R)-3,15,15-trimethylpentacyclo[6.5.1.13,6.02,7.09,13]pentadec-2(7)-ene-10,12-dione |
|---|---|
| PubChem CID | 125034852 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | (1S,3S,6R,8S,9S,13R)-3,15,15-trimethylpentacyclo[6.5.1.13,6.02,7.09,13]pentadec-2(7)-ene-10,12-dione |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)C1=C2[C@H]2C[C@H]1[C@H]1C(=O)CC(=O)[C@H]12 |
| InChI | InChI=1S/C18H22O2/c1-17(2)10-4-5-18(17,3)16-9-6-8(13(10)16)14-11(19)7-12(20)15(9)14/h8-10,14-15H,4-7H2,1-3H3/t8-,9+,10+,14-,15+,18-/m1/s1 |
| InChIKey | LWEFOCGAKDYFBQ-RFSNQSJLSA-N |
| XLogP | 3.16 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|