C16H24O2 — CID 125035129
(1S,2R,3R,5R,6S,8S,9S,11S,12R,13S)-pentacyclo[11.2.1.02,6.05,9.08,12]hexadecane-3,11-diol (PubChem CID 125035129) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (1S,2R,3R,5R,6S,8S,9S,11S,12R,13S)-pentacyclo[11.2.1.02,6.05,9.08,12]hexadecane-3,11-diol.
| Compound Name | (1S,2R,3R,5R,6S,8S,9S,11S,12R,13S)-pentacyclo[11.2.1.02,6.05,9.08,12]hexadecane-3,11-diol |
|---|---|
| PubChem CID | 125035129 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (1S,2R,3R,5R,6S,8S,9S,11S,12R,13S)-pentacyclo[11.2.1.02,6.05,9.08,12]hexadecane-3,11-diol |
| SMILES | O[C@@H]1C[C@@H]2[C@@H]3C[C@H](O)[C@@H]4[C@H]5CC[C@@H](C5)[C@@H]1[C@H]2C[C@@H]34 |
| InChI | InChI=1S/C16H24O2/c17-13-5-9-10-6-14(18)16-8-2-1-7(3-8)15(13)11(9)4-12(10)16/h7-18H,1-6H2/t7-,8-,9-,10+,11-,12-,13-,14+,15+,16+/m0/s1 |
| InChIKey | NSXXGNCZGKPXCV-BSBGWETCSA-N |
| XLogP | 2.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |