About CID 125035456
CID 125035456 (PubChem CID 125035456) has the molecular formula C16H18O5
and a molecular weight of 290.32 g/mol.
Molecular Properties
| Compound Name | CID 125035456 |
| PubChem CID | 125035456 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | — |
| SMILES | O=C1OC(=O)[C@H]2[C@@H]1[C@H]1C=C[C@H]2[C@@]2(CCCO2)[C@@]12CCCO2 |
| InChI | InChI=1S/C16H18O5/c17-13-11-9-3-4-10(12(11)14(18)21-13)16(6-2-8-20-16)15(9)5-1-7-19-15/h3-4,9-12H,1-2,5-8H2/t9-,10-,11-,12+,15+,16-/m1/s1 |
| InChIKey | PMWXIFKDHCXLAT-RSUATGCGSA-N |
| XLogP | 1.22 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 125035456 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 125035456?
The IUPAC name of CID 125035456 (CID 125035456) is not available.
What is the SMILES notation for CID 125035456?
The canonical SMILES for CID 125035456 is O=C1OC(=O)[C@H]2[C@@H]1[C@H]1C=C[C@H]2[C@@]2(CCCO2)[C@@]12CCCO2.
What is the InChIKey of CID 125035456?
The InChIKey is PMWXIFKDHCXLAT-RSUATGCGSA-N. The full InChI is InChI=1S/C16H18O5/c17-13-11-9-3-4-10(12(11)14(18)21-13)16(6-2-8-20-16)15(9)5-1-7-19-15/h3-4,9-12H,1-2,5-8H2/t9-,10-,11-,12+,15+,16-/m1/s1.
What are the key properties of CID 125035456?
CID 125035456 has a molecular weight of 290.32 g/mol, XLogP of 1.22, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 125035456 is sourced from PubChem (CID 125035456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).