C21H34O4Si — CID 125035546
(1S,2R,3R,7S)-1-methyl-6-methylidene-2-(2-trimethylsilylethoxymethoxy)-4-oxatricyclo[8.3.1.03,7]tetradec-10-en-5-one (PubChem CID 125035546) has the molecular formula C21H34O4Si and a molecular weight of 378.59 g/mol. Its IUPAC name is (1S,2R,3R,7S)-1-methyl-6-methylidene-2-(2-trimethylsilylethoxymethoxy)-4-oxatricyclo[8.3.1.03,7]tetradec-10-en-5-one.
| Compound Name | (1S,2R,3R,7S)-1-methyl-6-methylidene-2-(2-trimethylsilylethoxymethoxy)-4-oxatricyclo[8.3.1.03,7]tetradec-10-en-5-one |
|---|---|
| PubChem CID | 125035546 |
| Molecular Formula | C21H34O4Si |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | (1S,2R,3R,7S)-1-methyl-6-methylidene-2-(2-trimethylsilylethoxymethoxy)-4-oxatricyclo[8.3.1.03,7]tetradec-10-en-5-one |
| SMILES | C=C1C(=O)O[C@@H]2[C@H]1CCC1=CCC[C@@](C)(C1)[C@H]2OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C21H34O4Si/c1-15-17-9-8-16-7-6-10-21(2,13-16)19(18(17)25-20(15)22)24-14-23-11-12-26(3,4)5/h7,17-19H,1,6,8-14H2,2-5H3/t17-,18+,19-,21-/m0/s1 |
| InChIKey | PZUBRFJGQRFMIK-JTJHWIPRSA-N |
| XLogP | 4.69 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|