C16H20O4S — CID 125035873
[(1R,2R,4S,5R,6R)-6-methyl-3-oxatricyclo[3.2.1.02,4]octan-6-yl]methyl 4-methylbenzenesulfonate (PubChem CID 125035873) has the molecular formula C16H20O4S and a molecular weight of 308.40 g/mol. Its IUPAC name is [(1R,2R,4S,5R,6R)-6-methyl-3-oxatricyclo[3.2.1.02,4]octan-6-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1R,2R,4S,5R,6R)-6-methyl-3-oxatricyclo[3.2.1.02,4]octan-6-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 125035873 |
| Molecular Formula | C16H20O4S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | [(1R,2R,4S,5R,6R)-6-methyl-3-oxatricyclo[3.2.1.02,4]octan-6-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@]2(C)C[C@H]3C[C@H]2[C@@H]2O[C@H]32)cc1 |
| InChI | InChI=1S/C16H20O4S/c1-10-3-5-12(6-4-10)21(17,18)19-9-16(2)8-11-7-13(16)15-14(11)20-15/h3-6,11,13-15H,7-9H2,1-2H3/t11-,13+,14-,15+,16+/m1/s1 |
| InChIKey | RZFQDTSLWXFNGK-GAUGTXIDSA-N |
| XLogP | 2.51 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|