C13H12O2 — CID 125036000
methyl (2S,3S,4S,6S)-tetracyclo[5.4.0.02,4.03,6]undeca-1(11),7,9-triene-4-carboxylate (PubChem CID 125036000) has the molecular formula C13H12O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is methyl (2S,3S,4S,6S)-tetracyclo[5.4.0.02,4.03,6]undeca-1(11),7,9-triene-4-carboxylate.
| Compound Name | methyl (2S,3S,4S,6S)-tetracyclo[5.4.0.02,4.03,6]undeca-1(11),7,9-triene-4-carboxylate |
|---|---|
| PubChem CID | 125036000 |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | methyl (2S,3S,4S,6S)-tetracyclo[5.4.0.02,4.03,6]undeca-1(11),7,9-triene-4-carboxylate |
| SMILES | COC(=O)[C@]12C[C@@H]3c4ccccc4[C@@H]1[C@H]32 |
| InChI | InChI=1S/C13H12O2/c1-15-12(14)13-6-9-7-4-2-3-5-8(7)10(13)11(9)13/h2-5,9-11H,6H2,1H3/t9-,10-,11+,13-/m1/s1 |
| InChIKey | SRTJGPBDVOEMHP-HNCHTBHHSA-N |
| XLogP | 2.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |