C14H14N2O2 — CID 12503609
3-[(E)-2-nitroethenyl]-6,7,8,9-tetrahydro-1H-benzo[g]indole (PubChem CID 12503609) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 3-[(E)-2-nitroethenyl]-6,7,8,9-tetrahydro-1H-benzo[g]indole.
| Compound Name | 3-[(E)-2-nitroethenyl]-6,7,8,9-tetrahydro-1H-benzo[g]indole |
|---|---|
| PubChem CID | 12503609 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 3-[(E)-2-nitroethenyl]-6,7,8,9-tetrahydro-1H-benzo[g]indole |
| SMILES | O=[N+]([O-])/C=C/c1c[nH]c2c3c(ccc12)CCCC3 |
| InChI | InChI=1S/C14H14N2O2/c17-16(18)8-7-11-9-15-14-12-4-2-1-3-10(12)5-6-13(11)14/h5-9,15H,1-4H2/b8-7+ |
| InChIKey | OSAQVYFWBKSZNL-BQYQJAHWSA-N |
| XLogP | 3.29 |
| TPSA | 58.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|