C28H32O3 — CID 125036287
methyl (1R,3S,4S,5R,8R,10S,13R,14S,16R,17R,18S,19R)-15-(phenoxymethyl)octacyclo[8.8.1.02,9.03,17.04,8.05,16.013,19.014,18]nonadecane-15-carboxylate (PubChem CID 125036287) has the molecular formula C28H32O3 and a molecular weight of 416.56 g/mol. Its IUPAC name is methyl (1R,3S,4S,5R,8R,10S,13R,14S,16R,17R,18S,19R)-15-(phenoxymethyl)octacyclo[8.8.1.02,9.03,17.04,8.05,16.013,19.014,18]nonadecane-15-carboxylate.
| Compound Name | methyl (1R,3S,4S,5R,8R,10S,13R,14S,16R,17R,18S,19R)-15-(phenoxymethyl)octacyclo[8.8.1.02,9.03,17.04,8.05,16.013,19.014,18]nonadecane-15-carboxylate |
|---|---|
| PubChem CID | 125036287 |
| Molecular Formula | C28H32O3 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | methyl (1R,3S,4S,5R,8R,10S,13R,14S,16R,17R,18S,19R)-15-(phenoxymethyl)octacyclo[8.8.1.02,9.03,17.04,8.05,16.013,19.014,18]nonadecane-15-carboxylate |
| SMILES | COC(=O)C1(COc2ccccc2)[C@@H]2[C@@H]3CC[C@@H]4C5C6[C@H]7[C@H]8[C@@H](CC[C@@H]58)[C@H]1[C@@H]7[C@H]2[C@H]6[C@H]34 |
| InChI | InChI=1S/C28H32O3/c1-30-27(29)28(11-31-12-5-3-2-4-6-12)25-15-9-7-13-17-14-8-10-16-19(14)22-20(17)21(18(13)15)23(25)24(22)26(16)28/h2-6,13-26H,7-11H2,1H3/t13-,14+,15-,16-,17?,18+,19-,20?,21+,22-,23-,24+,25-,26+,28?/m1/s1 |
| InChIKey | VJYWVOALKMJEJP-HWZKPFDJSA-N |
| XLogP | 4.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |