C21H24O — CID 125036517
(1'R,2'S,4'S,7'S,10'S,11'S)-spiro[cyclopentane-1,9'-pentacyclo[9.3.2.14,7.02,10.03,8]heptadeca-3(8),13,15-triene]-12'-one (PubChem CID 125036517) has the molecular formula C21H24O and a molecular weight of 292.42 g/mol. Its IUPAC name is (1'R,2'S,4'S,7'S,10'S,11'S)-spiro[cyclopentane-1,9'-pentacyclo[9.3.2.14,7.02,10.03,8]heptadeca-3(8),13,15-triene]-12'-one.
| Compound Name | (1'R,2'S,4'S,7'S,10'S,11'S)-spiro[cyclopentane-1,9'-pentacyclo[9.3.2.14,7.02,10.03,8]heptadeca-3(8),13,15-triene]-12'-one |
|---|---|
| PubChem CID | 125036517 |
| Molecular Formula | C21H24O |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (1'R,2'S,4'S,7'S,10'S,11'S)-spiro[cyclopentane-1,9'-pentacyclo[9.3.2.14,7.02,10.03,8]heptadeca-3(8),13,15-triene]-12'-one |
| SMILES | O=C1C=C[C@H]2C=C[C@H]1[C@@H]1[C@H]2C2=C([C@H]3CC[C@H]2C3)C12CCCC2 |
| InChI | InChI=1S/C21H24O/c22-16-8-6-12-5-7-15(16)20-17(12)18-13-3-4-14(11-13)19(18)21(20)9-1-2-10-21/h5-8,12-15,17,20H,1-4,9-11H2/t12-,13+,14+,15-,17-,20-/m1/s1 |
| InChIKey | WVHARIACSCLREL-URVWZVLASA-N |
| XLogP | 4.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|