C21H30O4 — CID 125036533
2-[(3R,5S,8R,9R,10S,13S,14R)-3-hydroxy-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15-dodecahydrocyclopenta[a]phenanthren-17-yl]acetic acid (PubChem CID 125036533) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is 2-[(3R,5S,8R,9R,10S,13S,14R)-3-hydroxy-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15-dodecahydrocyclopenta[a]phenanthren-17-yl]acetic acid.
| Compound Name | 2-[(3R,5S,8R,9R,10S,13S,14R)-3-hydroxy-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15-dodecahydrocyclopenta[a]phenanthren-17-yl]acetic acid |
|---|---|
| PubChem CID | 125036533 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 2-[(3R,5S,8R,9R,10S,13S,14R)-3-hydroxy-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15-dodecahydrocyclopenta[a]phenanthren-17-yl]acetic acid |
| SMILES | C[C@]12CC[C@@H](O)C[C@@H]1CC[C@H]1[C@H]2C(=O)C[C@]2(C)C(CC(=O)O)=CC[C@H]12 |
| InChI | InChI=1S/C21H30O4/c1-20-8-7-14(22)9-12(20)3-5-15-16-6-4-13(10-18(24)25)21(16,2)11-17(23)19(15)20/h4,12,14-16,19,22H,3,5-11H2,1-2H3,(H,24,25)/t12-,14+,15+,16+,19-,20-,21+/m0/s1 |
| InChIKey | WXRCQADVBJRAON-AWNCOGSJSA-N |
| XLogP | 3.58 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|