C24H33N3O2 — CID 125036760
(1R,2R,6R,7S,10R)-8-[2-(diethylamino)ethyl]-10,11-dimethyl-4-phenyl-4,8-diazatricyclo[5.3.2.02,6]dodec-11-ene-3,5-dione (PubChem CID 125036760) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is (1R,2R,6R,7S,10R)-8-[2-(diethylamino)ethyl]-10,11-dimethyl-4-phenyl-4,8-diazatricyclo[5.3.2.02,6]dodec-11-ene-3,5-dione.
| Compound Name | (1R,2R,6R,7S,10R)-8-[2-(diethylamino)ethyl]-10,11-dimethyl-4-phenyl-4,8-diazatricyclo[5.3.2.02,6]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 125036760 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | (1R,2R,6R,7S,10R)-8-[2-(diethylamino)ethyl]-10,11-dimethyl-4-phenyl-4,8-diazatricyclo[5.3.2.02,6]dodec-11-ene-3,5-dione |
| SMILES | CCN(CC)CCN1C[C@H](C)[C@H]2C(C)=C[C@H]1[C@@H]1C(=O)N(c3ccccc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C24H33N3O2/c1-5-25(6-2)12-13-26-15-17(4)20-16(3)14-19(26)21-22(20)24(29)27(23(21)28)18-10-8-7-9-11-18/h7-11,14,17,19-22H,5-6,12-13,15H2,1-4H3/t17-,19-,20+,21-,22+/m0/s1 |
| InChIKey | YOGWHUBACZOGPE-TXZRGUEPSA-N |
| XLogP | 3.03 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|