C25H42O3Si — CID 125036864
(1R,4S,6R,7S,8S,14R)-6-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-4,7,14-trimethyltricyclo[5.4.3.01,8]tetradecane-3,9-dione (PubChem CID 125036864) has the molecular formula C25H42O3Si and a molecular weight of 418.69 g/mol. Its IUPAC name is (1R,4S,6R,7S,8S,14R)-6-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-4,7,14-trimethyltricyclo[5.4.3.01,8]tetradecane-3,9-dione.
| Compound Name | (1R,4S,6R,7S,8S,14R)-6-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-4,7,14-trimethyltricyclo[5.4.3.01,8]tetradecane-3,9-dione |
|---|---|
| PubChem CID | 125036864 |
| Molecular Formula | C25H42O3Si |
| Molecular Weight | 418.69 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | (1R,4S,6R,7S,8S,14R)-6-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-4,7,14-trimethyltricyclo[5.4.3.01,8]tetradecane-3,9-dione |
| SMILES | C=C[C@]1(C)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@]2(C)[C@H](C)CC[C@@]3(CCC(=O)[C@@H]32)CC1=O |
| InChI | InChI=1S/C25H42O3Si/c1-10-23(6)16-20(28-29(8,9)22(3,4)5)24(7)17(2)11-13-25(15-19(23)27)14-12-18(26)21(24)25/h10,17,20-21H,1,11-16H2,2-9H3/t17-,20-,21-,23-,24-,25-/m1/s1 |
| InChIKey | ZCOFQGMDQIWFAO-IWTVZHICSA-N |
| XLogP | 6.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.69 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|