C8H10F2O — CID 125041568
(3aR,6aR)-5,5-difluoro-1,3,3a,4,6,6a-hexahydropentalen-2-one (PubChem CID 125041568) has the molecular formula C8H10F2O and a molecular weight of 160.16 g/mol. Its IUPAC name is (3aR,6aR)-5,5-difluoro-1,3,3a,4,6,6a-hexahydropentalen-2-one.
| Compound Name | (3aR,6aR)-5,5-difluoro-1,3,3a,4,6,6a-hexahydropentalen-2-one |
|---|---|
| PubChem CID | 125041568 |
| Molecular Formula | C8H10F2O |
| Molecular Weight | 160.16 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | (3aR,6aR)-5,5-difluoro-1,3,3a,4,6,6a-hexahydropentalen-2-one |
| SMILES | O=C1C[C@@H]2CC(F)(F)C[C@H]2C1 |
| InChI | InChI=1S/C8H10F2O/c9-8(10)3-5-1-7(11)2-6(5)4-8/h5-6H,1-4H2/t5-,6-/m1/s1 |
| InChIKey | XLXHKWUHWJMLKF-PHDIDXHHSA-N |
| XLogP | 2.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.16 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |