C18H28N2O5S2 — CID 125042948
(3S)-1-ethylsulfonyl-N-[(1S)-1-(4-methylsulfonylphenyl)propyl]piperidine-3-carboxamide (PubChem CID 125042948) has the molecular formula C18H28N2O5S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is (3S)-1-ethylsulfonyl-N-[(1S)-1-(4-methylsulfonylphenyl)propyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-ethylsulfonyl-N-[(1S)-1-(4-methylsulfonylphenyl)propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 125042948 |
| Molecular Formula | C18H28N2O5S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | (3S)-1-ethylsulfonyl-N-[(1S)-1-(4-methylsulfonylphenyl)propyl]piperidine-3-carboxamide |
| SMILES | CC[C@H](NC(=O)[C@H]1CCCN(S(=O)(=O)CC)C1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H28N2O5S2/c1-4-17(14-8-10-16(11-9-14)26(3,22)23)19-18(21)15-7-6-12-20(13-15)27(24,25)5-2/h8-11,15,17H,4-7,12-13H2,1-3H3,(H,19,21)/t15-,17-/m0/s1 |
| InChIKey | YGGCAZGGPPDAPD-RDJZCZTQSA-N |
| XLogP | 1.72 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |