C11H24O4Si — CID 12504386
(3,3-dimethyloxiran-2-yl)methyl-triethoxysilane (PubChem CID 12504386) has the molecular formula C11H24O4Si and a molecular weight of 248.39 g/mol. Its IUPAC name is (3,3-dimethyloxiran-2-yl)methyl-triethoxysilane.
| Compound Name | (3,3-dimethyloxiran-2-yl)methyl-triethoxysilane |
|---|---|
| PubChem CID | 12504386 |
| Molecular Formula | C11H24O4Si |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (3,3-dimethyloxiran-2-yl)methyl-triethoxysilane |
| SMILES | CCO[Si](CC1OC1(C)C)(OCC)OCC |
| InChI | InChI=1S/C11H24O4Si/c1-6-12-16(13-7-2,14-8-3)9-10-11(4,5)15-10/h10H,6-9H2,1-5H3 |
| InChIKey | WNZCENKNNZKFMY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|