About 4-chloroiminocyclohexa-2,5-dien-1-one
4-chloroiminocyclohexa-2,5-dien-1-one (PubChem CID 12505) has the molecular formula C6H4ClNO
and a molecular weight of 141.56 g/mol. Its IUPAC name is 4-chloroiminocyclohexa-2,5-dien-1-one.
Molecular Properties
| Compound Name | 4-chloroiminocyclohexa-2,5-dien-1-one |
| PubChem CID | 12505 |
| Molecular Formula | C6H4ClNO |
| Molecular Weight | 141.56 g/mol |
| Exact Mass | 141.00 |
| IUPAC Name | 4-chloroiminocyclohexa-2,5-dien-1-one |
| SMILES | O=C1C=CC(=NCl)C=C1 |
| InChI | InChI=1S/C6H4ClNO/c7-8-5-1-3-6(9)4-2-5/h1-4H |
| InChIKey | ITUYMTWJWYTELW-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.56 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-chloroiminocyclohexa-2,5-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloroiminocyclohexa-2,5-dien-1-one?
The IUPAC name of 4-chloroiminocyclohexa-2,5-dien-1-one (CID 12505) is 4-chloroiminocyclohexa-2,5-dien-1-one.
What is the SMILES notation for 4-chloroiminocyclohexa-2,5-dien-1-one?
The canonical SMILES for 4-chloroiminocyclohexa-2,5-dien-1-one is O=C1C=CC(=NCl)C=C1.
What is the InChIKey of 4-chloroiminocyclohexa-2,5-dien-1-one?
The InChIKey is ITUYMTWJWYTELW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClNO/c7-8-5-1-3-6(9)4-2-5/h1-4H.
What are the key properties of 4-chloroiminocyclohexa-2,5-dien-1-one?
4-chloroiminocyclohexa-2,5-dien-1-one has a molecular weight of 141.56 g/mol, XLogP of 1.28, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloroiminocyclohexa-2,5-dien-1-one is sourced from PubChem (CID 12505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).