C21H23N3O3S — CID 125052786
(2R,5R,6R)-2-methyl-5-(6-propoxy-1,3-benzodioxol-5-yl)-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 125052786) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is (2R,5R,6R)-2-methyl-5-(6-propoxy-1,3-benzodioxol-5-yl)-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | (2R,5R,6R)-2-methyl-5-(6-propoxy-1,3-benzodioxol-5-yl)-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 125052786 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | (2R,5R,6R)-2-methyl-5-(6-propoxy-1,3-benzodioxol-5-yl)-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| SMILES | CCCOc1cc2c(cc1[C@@H]1[C@H](c3ccccn3)N=C3S[C@H](C)CN31)OCO2 |
| InChI | InChI=1S/C21H23N3O3S/c1-3-8-25-16-10-18-17(26-12-27-18)9-14(16)20-19(15-6-4-5-7-22-15)23-21-24(20)11-13(2)28-21/h4-7,9-10,13,19-20H,3,8,11-12H2,1-2H3/t13-,19+,20-/m1/s1 |
| InChIKey | IKIPGGZFXIEIDM-CAYVGHNUSA-N |
| XLogP | 4.19 |
| TPSA | 56.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |