About 2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-1,2-diphenylethanol
2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-1,2-diphenylethanol (PubChem CID 12505335) has the molecular formula C26H30N2O2
and a molecular weight of 402.54 g/mol. Its IUPAC name is 2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-1,2-diphenylethanol.
Molecular Properties
| Compound Name | 2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-1,2-diphenylethanol |
| PubChem CID | 12505335 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-1,2-diphenylethanol |
| SMILES | COc1ccc(CN2CCN(C(c3ccccc3)C(O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H30N2O2/c1-30-24-14-12-21(13-15-24)20-27-16-18-28(19-17-27)25(22-8-4-2-5-9-22)26(29)23-10-6-3-7-11-23/h2-15,25-26,29H,16-20H2,1H3 |
| InChIKey | LYTUIICOBLXIQR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-1,2-diphenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-1,2-diphenylethanol?
The IUPAC name of 2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-1,2-diphenylethanol (CID 12505335) is 2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-1,2-diphenylethanol.
What is the SMILES notation for 2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-1,2-diphenylethanol?
The canonical SMILES for 2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-1,2-diphenylethanol is COc1ccc(CN2CCN(C(c3ccccc3)C(O)c3ccccc3)CC2)cc1.
What is the InChIKey of 2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-1,2-diphenylethanol?
The InChIKey is LYTUIICOBLXIQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H30N2O2/c1-30-24-14-12-21(13-15-24)20-27-16-18-28(19-17-27)25(22-8-4-2-5-9-22)26(29)23-10-6-3-7-11-23/h2-15,25-26,29H,16-20H2,1H3.
What are the key properties of 2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-1,2-diphenylethanol?
2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-1,2-diphenylethanol has a molecular weight of 402.54 g/mol, XLogP of 4.29, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]-1,2-diphenylethanol is sourced from PubChem (CID 12505335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).