C28H32IN3O4S — CID 125053737
(2R)-2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(2-methylphenyl)methyl]amino]-N-propan-2-ylpropanamide (PubChem CID 125053737) has the molecular formula C28H32IN3O4S and a molecular weight of 633.55 g/mol. Its IUPAC name is (2R)-2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(2-methylphenyl)methyl]amino]-N-propan-2-ylpropanamide.
| Compound Name | (2R)-2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(2-methylphenyl)methyl]amino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 125053737 |
| Molecular Formula | C28H32IN3O4S |
| Molecular Weight | 633.55 g/mol |
| Exact Mass | 633.12 |
| IUPAC Name | (2R)-2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(2-methylphenyl)methyl]amino]-N-propan-2-ylpropanamide |
| SMILES | Cc1ccccc1CN(C(=O)CN(c1ccc(I)cc1)S(=O)(=O)c1ccccc1)[C@H](C)C(=O)NC(C)C |
| InChI | InChI=1S/C28H32IN3O4S/c1-20(2)30-28(34)22(4)31(18-23-11-9-8-10-21(23)3)27(33)19-32(25-16-14-24(29)15-17-25)37(35,36)26-12-6-5-7-13-26/h5-17,20,22H,18-19H2,1-4H3,(H,30,34)/t22-/m1/s1 |
| InChIKey | VKGKMQWTXGAFGU-JOCHJYFZSA-N |
| XLogP | 4.74 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.55 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|