C28H39N3O4S — CID 125056160
N-benzyl-N-[(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl]-4-(3-methyl-N-methylsulfonylanilino)butanamide (PubChem CID 125056160) has the molecular formula C28H39N3O4S and a molecular weight of 513.70 g/mol. Its IUPAC name is N-benzyl-N-[(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl]-4-(3-methyl-N-methylsulfonylanilino)butanamide.
| Compound Name | N-benzyl-N-[(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl]-4-(3-methyl-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 125056160 |
| Molecular Formula | C28H39N3O4S |
| Molecular Weight | 513.70 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | N-benzyl-N-[(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl]-4-(3-methyl-N-methylsulfonylanilino)butanamide |
| SMILES | Cc1cccc(N(CCCC(=O)N(Cc2ccccc2)[C@H](C)C(=O)NC2CCCCC2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C28H39N3O4S/c1-22-12-10-17-26(20-22)31(36(3,34)35)19-11-18-27(32)30(21-24-13-6-4-7-14-24)23(2)28(33)29-25-15-8-5-9-16-25/h4,6-7,10,12-14,17,20,23,25H,5,8-9,11,15-16,18-19,21H2,1-3H3,(H,29,33)/t23-/m1/s1 |
| InChIKey | JNAWYSVVRKKXMX-HSZRJFAPSA-N |
| XLogP | 4.41 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.70 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |