C21H22FN3O — CID 1250568
3-(3-fluorophenyl)imino-1-[(4-methylpiperidin-1-yl)methyl]indol-2-one (PubChem CID 1250568) has the molecular formula C21H22FN3O and a molecular weight of 351.43 g/mol. Its IUPAC name is 3-(3-fluorophenyl)imino-1-[(4-methylpiperidin-1-yl)methyl]indol-2-one.
| Compound Name | 3-(3-fluorophenyl)imino-1-[(4-methylpiperidin-1-yl)methyl]indol-2-one |
|---|---|
| PubChem CID | 1250568 |
| Molecular Formula | C21H22FN3O |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 3-(3-fluorophenyl)imino-1-[(4-methylpiperidin-1-yl)methyl]indol-2-one |
| SMILES | CC1CCN(CN2C(=O)/C(=N\c3cccc(F)c3)c3ccccc32)CC1 |
| InChI | InChI=1S/C21H22FN3O/c1-15-9-11-24(12-10-15)14-25-19-8-3-2-7-18(19)20(21(25)26)23-17-6-4-5-16(22)13-17/h2-8,13,15H,9-12,14H2,1H3/b23-20- |
| InChIKey | YZCJMBXHWPHCQW-ATJXCDBQSA-N |
| XLogP | 3.98 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|