C26H30N2O3S — CID 125058105
2-(2-ethyl-N-(4-methylphenyl)sulfonylanilino)-N-[(2R)-2-phenylpropyl]acetamide (PubChem CID 125058105) has the molecular formula C26H30N2O3S and a molecular weight of 450.60 g/mol. Its IUPAC name is 2-(2-ethyl-N-(4-methylphenyl)sulfonylanilino)-N-[(2R)-2-phenylpropyl]acetamide.
| Compound Name | 2-(2-ethyl-N-(4-methylphenyl)sulfonylanilino)-N-[(2R)-2-phenylpropyl]acetamide |
|---|---|
| PubChem CID | 125058105 |
| Molecular Formula | C26H30N2O3S |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 2-(2-ethyl-N-(4-methylphenyl)sulfonylanilino)-N-[(2R)-2-phenylpropyl]acetamide |
| SMILES | CCc1ccccc1N(CC(=O)NC[C@H](C)c1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H30N2O3S/c1-4-22-10-8-9-13-25(22)28(32(30,31)24-16-14-20(2)15-17-24)19-26(29)27-18-21(3)23-11-6-5-7-12-23/h5-17,21H,4,18-19H2,1-3H3,(H,27,29)/t21-/m0/s1 |
| InChIKey | WUUIUVMXMARMFZ-NRFANRHFSA-N |
| XLogP | 4.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |