C30H34N4O7S — CID 125058587
(2R)-2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(4-methoxyphenyl)methyl]amino]-N-cyclopentylpropanamide (PubChem CID 125058587) has the molecular formula C30H34N4O7S and a molecular weight of 594.69 g/mol. Its IUPAC name is (2R)-2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(4-methoxyphenyl)methyl]amino]-N-cyclopentylpropanamide.
| Compound Name | (2R)-2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(4-methoxyphenyl)methyl]amino]-N-cyclopentylpropanamide |
|---|---|
| PubChem CID | 125058587 |
| Molecular Formula | C30H34N4O7S |
| Molecular Weight | 594.69 g/mol |
| Exact Mass | 594.21 |
| IUPAC Name | (2R)-2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(4-methoxyphenyl)methyl]amino]-N-cyclopentylpropanamide |
| SMILES | COc1ccc(CN(C(=O)CN(c2ccc([N+](=O)[O-])cc2)S(=O)(=O)c2ccccc2)[C@H](C)C(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C30H34N4O7S/c1-22(30(36)31-24-8-6-7-9-24)32(20-23-12-18-27(41-2)19-13-23)29(35)21-33(25-14-16-26(17-15-25)34(37)38)42(39,40)28-10-4-3-5-11-28/h3-5,10-19,22,24H,6-9,20-21H2,1-2H3,(H,31,36)/t22-/m1/s1 |
| InChIKey | OVCSXDHOZDFXMM-JOCHJYFZSA-N |
| XLogP | 4.27 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.69 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|