C9H13F4NO — CID 12505908
(Z)-5-amino-1,1,2,2-tetrafluoronon-4-en-3-one (PubChem CID 12505908) has the molecular formula C9H13F4NO and a molecular weight of 227.20 g/mol. Its IUPAC name is (Z)-5-amino-1,1,2,2-tetrafluoronon-4-en-3-one.
| Compound Name | (Z)-5-amino-1,1,2,2-tetrafluoronon-4-en-3-one |
|---|---|
| PubChem CID | 12505908 |
| Molecular Formula | C9H13F4NO |
| Molecular Weight | 227.20 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | (Z)-5-amino-1,1,2,2-tetrafluoronon-4-en-3-one |
| SMILES | CCCC/C(N)=C/C(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H13F4NO/c1-2-3-4-6(14)5-7(15)9(12,13)8(10)11/h5,8H,2-4,14H2,1H3/b6-5- |
| InChIKey | GJYODMAPDAYDFO-WAYWQWQTSA-N |
| XLogP | 2.49 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.20 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|