C23H36N2O3 — CID 125061179
(2S)-2-cyclopropyl-2-ethoxy-N-[4-[3-[(3S)-3-methylpiperidin-1-yl]propoxy]phenyl]propanamide (PubChem CID 125061179) has the molecular formula C23H36N2O3 and a molecular weight of 388.55 g/mol. Its IUPAC name is (2S)-2-cyclopropyl-2-ethoxy-N-[4-[3-[(3S)-3-methylpiperidin-1-yl]propoxy]phenyl]propanamide.
| Compound Name | (2S)-2-cyclopropyl-2-ethoxy-N-[4-[3-[(3S)-3-methylpiperidin-1-yl]propoxy]phenyl]propanamide |
|---|---|
| PubChem CID | 125061179 |
| Molecular Formula | C23H36N2O3 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.27 |
| IUPAC Name | (2S)-2-cyclopropyl-2-ethoxy-N-[4-[3-[(3S)-3-methylpiperidin-1-yl]propoxy]phenyl]propanamide |
| SMILES | CCO[C@](C)(C(=O)Nc1ccc(OCCCN2CCC[C@H](C)C2)cc1)C1CC1 |
| InChI | InChI=1S/C23H36N2O3/c1-4-28-23(3,19-8-9-19)22(26)24-20-10-12-21(13-11-20)27-16-6-15-25-14-5-7-18(2)17-25/h10-13,18-19H,4-9,14-17H2,1-3H3,(H,24,26)/t18-,23-/m0/s1 |
| InChIKey | SCOHBCRROGAADD-MBSDFSHPSA-N |
| XLogP | 4.33 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|